6-iodo-3-(2-phenylethyl)-2-[(E)-2-(thiophen-2-yl)ethenyl]quinazolin-4(3H)-one
6-iodo-3-(2-phenylethyl)-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-one
Also Known As: 6-iodo-3-phenethyl-2-(2-thiophen-2-ylethenyl)quinazolin-4-one|6-iodo-3-phenethyl-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-one|(E)-6-iodo-3-phenethyl-2-(2-(thiophen-2-yl)vinyl)quinazolin-4(3H)-one|6-iodo-3-(2-phenylethyl)-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-one|6-iodo-3-(2-phenylethyl)-2-[(E)-2-(thiophen-2-yl)ethenyl]quinazolin-4(3H)-one
| Molecular Formula | C22H17IN2OS |
|---|---|
| Molecular Weight | 484.01062 g/mol |
| LogP | 5.4757 |
| Topological Polar Surface Area | 34.89 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 484.01062 |
| Monoisotopic Mass | 484.01062 |
| Heavy Atoms | 27 |
| Complexity | 1148.3752 |
Chemical Identifiers
| CAS Number | 694475-36-0 |
|---|---|
| SMILES | C1=CC=C(C=C1)CCN2C(=NC3=C(C2=O)C=C(C=C3)I)/C=C/C4=CC=CS4 |
Product Overview
6-iodo-3-(2-phenylethyl)-2-[(E)-2-(thiophen-2-yl)ethenyl]quinazolin-4(3H)-one (CAS 694475-36-0), with molecular formula C22H17IN2OS and molecular weight 484.01062 g/mol. IUPAC: 6-iodo-3-(2-phenylethyl)-2-[(E)-2-thiophen-2-ylethenyl]quinazolin-4-one.
6-iodo-3-(2-phenylethyl)-2-[(E)-2-(thiophen-2-yl)ethenyl]quinazolin-4(3H)-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »