2-Amino-1,3-dibromoanthraquinone
2-amino-1,3-dibromoanthracene-9,10-dione
Also Known As: 2-Amino-1,3-dibromoanthraquinone|2-amino-1,3-dibromoanthracene-9,10-dione|Anthraquinone,3-dibromo-|9, 2-amino-1,3-dibromo-|2-Amino-1,3-dibromo-anthraquinone|Anthraquinone, 2-amino-1,3-dibromo-|BAS 02800810|1,3-Dibromo-2-amino-9,10-anthraquinone|9,10-Anthracenedione, 2-amino-1,3-dibromo-|2-amino-1,3-dibromo-anthracene-9,10-dione|9,10-Anthracenedione,2-amino-1,3-dibromo-|J3.346.574B|SR-01000312395-1|2-AMINO-1,3-DIBROMO-9,10-DIHYDROANTHRACENE-9,10-DIONE
| Molecular Formula | C14H7Br2NO2 |
|---|---|
| Molecular Weight | 378.88434 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 60.2 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 0 |
| Exact Mass | 378.88434 |
| Monoisotopic Mass | 378.88434 |
| Heavy Atoms | 19 |
| Complexity | 414.0 |
Chemical Identifiers
| CAS Number | 6949-89-9 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)Br)N)Br |
| InChIKey | ZDNLBGNACWKHAX-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-Amino-1,3-dibromoanthraquinone (CAS 6949-89-9), with molecular formula C14H7Br2NO2 and molecular weight 378.88434 g/mol. IUPAC: 2-amino-1,3-dibromoanthracene-9,10-dione.