2,2,2-Trichloro-1-(diethoxyphosphoryl)ethyl pentanoate
(2,2,2-trichloro-1-diethoxyphosphorylethyl) pentanoate
Also Known As: Valericacid2,2,2-trichloro-1- ethylester|2,2,2-Trichloro-1-(diethoxyphosphoryl)ethyl pentanoate|O,O-Diethyl 2,2,2-trichloro-1-valeryloxy ethyl phosphonate|Phosphonic acid, (2,2,2-trichloro-1-hydroxyethyl)-, diethyl ester, valerate|(2,2,2-trichloro-1-diethoxyphosphorylethyl) pentanoate|Valeric acid 2,2,2-trichloro-1-(diethoxyphosphinyl)ethyl ester|Valeric acid, ester with diethyl (2,2,2-trichloro-1-hydroxyethyl)phosphonate|Pentanoic acid, 2,2,2-trichloro-1-(diethoxyphosphinyl)ethyl ester
| Molecular Formula | C11H20Cl3O5P |
|---|---|
| Molecular Weight | 368.01138 g/mol |
| LogP | 4.6822 |
| Topological Polar Surface Area | 61.83 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Exact Mass | 368.01138 |
| Monoisotopic Mass | 368.01138 |
| Heavy Atoms | 20 |
| Complexity | 335.44052 |
Chemical Identifiers
| CAS Number | 69494-08-2 |
|---|---|
| SMILES | CCCCC(=O)OC(C(Cl)(Cl)Cl)P(=O)(OCC)OCC |
Product Overview
2,2,2-Trichloro-1-(diethoxyphosphoryl)ethyl pentanoate (CAS 69494-08-2), with molecular formula C11H20Cl3O5P and molecular weight 368.01138 g/mol. IUPAC: (2,2,2-trichloro-1-diethoxyphosphorylethyl) pentanoate.