Benzophenone, 4,4'-bisacetyloxy-
[4-(4-acetyloxybenzoyl)phenyl] acetate
Also Known As: Benzophenone, 4,4'-bisacetyloxy-|[4-(4-acetyloxybenzoyl)phenyl] acetate|4,4'-Diacetoxybenzophenon|TimTec1_005550|Oprea1_272235|4,4 -Diacetoxybenzophenone|4,4'-DIACETOXYBENZOPHENONE|Benzophenone,4,4'-bisacetyloxy-|4-[4-(Acetyloxy)benzoyl]phenyl acetate|Carbonyldi(4,1-phenylene) diacetate|carbonyldibenzene-4,1-diyl diacetate|carbonylbis(4,1-phenylene) diacetate|[4-(4-acetoxybenzoyl)phenyl] acetate|Benzophenone, 4,4'-dihydroxy- diacetate|NCGC00173111-01|4-[4-(Acetyloxy)benzoyl]phenyl acetate #|Benzophenone, 4,4'-dihydroxy-, diacetate|Diacetic acid carbonylbis(p-phenylene) ester|4-[(4-acetyloxyphenyl)carbonyl]phenyl acetate|SR-01000392948-1|A0770/0036028
| Molecular Formula | C17H14O5 |
|---|---|
| Molecular Weight | 298.08414 g/mol |
| LogP | 2.7 |
| Topological Polar Surface Area | 69.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 298.08414 |
| Monoisotopic Mass | 298.08414 |
| Heavy Atoms | 22 |
| Complexity | 377.0 |
Chemical Identifiers
| CAS Number | 6952-48-3 |
|---|---|
| SMILES | CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OC(=O)C |
| InChIKey | AKYQJYBGYJXEJX-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzophenone, 4,4'-bisacetyloxy- (CAS 6952-48-3), with molecular formula C17H14O5 and molecular weight 298.08414 g/mol. IUPAC: [4-(4-acetyloxybenzoyl)phenyl] acetate.