![4-[(4-Bromophenyl)hydrazinylidene]naphthalen-1-one structure](/static/products/6953/6953-40-8.webp)
4-[(4-Bromophenyl)hydrazinylidene]naphthalen-1-one
4-[(4-bromophenyl)diazenyl]naphthalen-1-ol
Also Known As: NCIOpen2_008526|4-(4-Bromophenylazo)-1-naphthol|4-[(4-bromophenyl)hydrazinylidene]naphthalen-1-one|4-[(4-Bromophenyl)diazenyl]naphthalen-1-ol|J2.263.670G|4-[2-(4-Bromophenyl)diazenyl]-1-naphthalenol|(4E)-4-[(4-bromophenyl)hydrazinylidene]naphthalen-1-one|4-[2-(4-bromophenyl)diazen-1-yl]naphthalen-1-ol|(4Z)-4-[(4-bromophenyl)hydrazinylidene]naphthalen-1-one
| Molecular Formula | C16H11BrN2O |
|---|---|
| Molecular Weight | 326.0055 g/mol |
| LogP | 5.3 |
| Topological Polar Surface Area | 45.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 326.0055 |
| Monoisotopic Mass | 326.0055 |
| Heavy Atoms | 20 |
| Complexity | 341.0 |
Chemical Identifiers
| CAS Number | 6953-40-8 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)N=NC3=CC=C(C=C3)Br |
| InChIKey | DFWSNPWQTITSLU-UHFFFAOYSA-N |
Product Overview
4-[(4-Bromophenyl)hydrazinylidene]naphthalen-1-one (CAS 6953-40-8), with molecular formula C16H11BrN2O and molecular weight 326.0055 g/mol. IUPAC: 4-[(4-bromophenyl)diazenyl]naphthalen-1-ol.
4-[(4-Bromophenyl)hydrazinylidene]naphthalen-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »