2,5-Dimethylbenzenesulfonamide
2,5-dimethylbenzenesulfonamide
Also Known As: 2,5-dimethylbenzenesulfonamide|2,5-Dimethyl-benzenesulfonamide|p-Xylolsulfamid|2,5-dimethylbenzene-1-sulfonamide|2,5-Xylenesulfonamide|p-2-xylenesulfonamide|Benzenesulfonamide,2,5-dimethyl-|Benzenesulfonamide, 2,5-dimethyl- (9CI)|Benzenesulfonamide,2,4-dimethyl-|2,5-dimethylbenzenesulphonamide|Benzenesulfonamide, 2,5-dimethyl-|GS0927|J1.226.918H|L-4460|F0808-2049|101-907-5
| Molecular Formula | C8H11NO2S |
|---|---|
| Molecular Weight | 185.05106 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 68.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 185.05106 |
| Monoisotopic Mass | 185.05106 |
| Heavy Atoms | 12 |
| Complexity | 242.0 |
Chemical Identifiers
| CAS Number | 6953-62-4 |
|---|---|
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)N |
| InChIKey | STZQAGJQPZCAED-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,5-Dimethylbenzenesulfonamide (CAS 6953-62-4), with molecular formula C8H11NO2S and molecular weight 185.05106 g/mol. IUPAC: 2,5-dimethylbenzenesulfonamide.
2,5-Dimethylbenzenesulfonamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »