2,6-Dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one
2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one
Also Known As: NCIOpen2_002888|2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one|2,5-Cyclohexadien-1-one,2,6-dichloro-4-methyl-4-(trichloromethyl)-|AO-840/42717669|1-Methyl-1-trichlormethyl-3,5-dichlor-cyclohexadien-(2,5)-ol-(4)|2,6-dichloro-4-methyl-4-trichloromethyl-cyclohexa-2,5-dienol|2,6-dichloro-4-methyl-4-(trichloromethyl)-2,5-cyclohexadien-1-one
| Molecular Formula | C8H5Cl5O |
|---|---|
| Molecular Weight | 291.8783 g/mol |
| LogP | 5.0 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 291.8783 |
| Monoisotopic Mass | 291.8783 |
| Heavy Atoms | 14 |
| Complexity | 314.0 |
Chemical Identifiers
| CAS Number | 6956-79-2 |
|---|---|
| SMILES | CC1(C=C(C(=O)C(=C1)Cl)Cl)C(Cl)(Cl)Cl |
| InChIKey | UKZRDSWXCVWWLD-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2,6-Dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one (CAS 6956-79-2), with molecular formula C8H5Cl5O and molecular weight 291.8783 g/mol. IUPAC: 2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one.