![3-[3-[Bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one structure](/static/products/6956/69561-27-9.webp)
3-[3-[Bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one
3-[3-[bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one
Also Known As: 3-[3-[bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one|3-[3-[bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazo|3-(3-{[Bis(2-chloroethyl)amino]methyl}-4-hydroxyphenyl)quinazolin-4(3H)-one|4(3H)-QUINAZOLINONE,3-[3-[[BIS(2-CHLOROETHYL)AMINO]METHYL]-4-HYDROXYPHENYL]-
| Molecular Formula | C19H19Cl2N3O2 |
|---|---|
| Molecular Weight | 391.08542 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 56.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 391.08542 |
| Monoisotopic Mass | 391.08542 |
| Heavy Atoms | 26 |
| Complexity | 499.0 |
Chemical Identifiers
| CAS Number | 69561-27-9 |
|---|---|
| SMILES | C1=CC=C2C(=C1)C(=O)N(C=N2)C3=CC(=C(C=C3)O)CN(CCCl)CCCl |
| InChIKey | INEZIADVQVHFMT-UHFFFAOYSA-N |
Product Overview
3-[3-[Bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one (CAS 69561-27-9), with molecular formula C19H19Cl2N3O2 and molecular weight 391.08542 g/mol. IUPAC: 3-[3-[bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one.
3-[3-[Bis(2-chloroethyl)aminomethyl]-4-hydroxyphenyl]quinazolin-4-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »