9,10-Dihydro-9,10-ethanoanthracene-11-carbonitrile
tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonitrile
Also Known As: Oprea1_471927|9,10-dihydro-9,10-ethanoanthracene-11-carbonitrile|11-cyano-9,10-dihydro-9,10-ethanoanthracene|11-cyano-9,10-dihydro-9,10-ethano-anthracene|tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonitrile|11-CYANOMETHYL-9,10-DIHYDRO-9,10-ETHANOANTHRACENE|2,3-(9,10-Dihydroanthracene-9,10-diyl)propanenitrile|tetracyclo[6.6.2.0^{2,7}.0^{9,14}]hexadeca-2(7),3,5,9(14),10,12-hexaene-15-carbonitrile
| Molecular Formula | C17H13N |
|---|---|
| Molecular Weight | 231.1048 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 23.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 0 |
| Exact Mass | 231.1048 |
| Monoisotopic Mass | 231.1048 |
| Heavy Atoms | 18 |
| Complexity | 354.0 |
Chemical Identifiers
| CAS Number | 6965-02-2 |
|---|---|
| SMILES | C1C(C2C3=CC=CC=C3C1C4=CC=CC=C24)C#N |
| InChIKey | XPVVUQSODGYUPA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
9,10-Dihydro-9,10-ethanoanthracene-11-carbonitrile (CAS 6965-02-2), with molecular formula C17H13N and molecular weight 231.1048 g/mol. IUPAC: tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonitrile.