4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine
4-(4-fluorophenyl)-1-methyl-3,6-dihydro-2H-pyridine
Also Known As: Paroxetine EP impurity G|4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine|Paroxetine Impurity G|Sturin A|9-octadecenyl iodide|Paroxetine Impurity 50|4-(4-fluorophenyl)-1-methyl-3,6-dihydro-2H-pyridine|Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-1-methyl-|4-(4-FLUOROPHENYL)-1,2,3,6-TETRAHYDRO-1-METHYLPYRIDINE|PAROXETINE HYDROCHLORIDE RELATED COMPOUND E [USP IMPURITY]|1-METHYL-4-(4'-FLUOROPHENYL)-1,2,3,6-TETRAHYDROPYRIDINE|1-Methyl-4-(4-fluorophenyl)-1,2,3,6-tetrahydropyridine|4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydro pyridine|B2694-370199|PAROXETINE HYDROCHLORIDE RELATED COMPOUND E (USP IMPURITY)|Paroxetine Hydrochloride Anhydrous EP Impurity G; Paroxetine Hydrochloride EP Impurity G; Paroxetine Hydrochloride Hemihydrate EP Impurity G|Pyridine, 4-(4-fluorophenyl)-1,2,3,6-tetrahydro-1-methyl-; 4-(4-Fluorophenyl)-1,2,3,6-tetrahydro-1-methylpyridine; 1-Methyl-4-(4'-fluorophenyl)-1,2,3,6-tetrahydropyridine; 4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine; Paroxetine Hydrochloride Hemihydrate Imp. G (EP); Spiked with Ph Eur Paroxetine Hydrochloride Impurity G; BRL-55490 (F-THP)
| Molecular Formula | C12H14FN |
|---|---|
| Molecular Weight | 191.11102 g/mol |
| LogP | 2.8 |
| Topological Polar Surface Area | 3.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 191.11102 |
| Monoisotopic Mass | 191.11102 |
| Heavy Atoms | 14 |
| Complexity | 216.0 |
Chemical Identifiers
| CAS Number | 69675-10-1 |
|---|---|
| SMILES | CN1CCC(=CC1)C2=CC=C(C=C2)F |
| InChIKey | FYGWJEDFEJZMIC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine (CAS 69675-10-1), with molecular formula C12H14FN and molecular weight 191.11102 g/mol. IUPAC: 4-(4-fluorophenyl)-1-methyl-3,6-dihydro-2H-pyridine.