Methyl 3-(bis(2-methoxycarbonylethyl)amino)propanoate
methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate
Also Known As: tris(2-methoxycarbonylethyl)amine|TRIMETHYL NITRILOTRIPROPIONATE|2,5-Dinitrobenzenesulfonic acid hydrate|methyl 3-(bis(2-methoxycarbonylethyl)amino)propanoate|methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate|Trimethyl 3,3',3''-nitrilotripropanoate|J1.002.970H|3,3',3''-nitrilo-tri-propionic acid trimethyl ester|trimethyl 3,3',3''-nitrilotripropanoate(non-preferred name)|3,3 ,3 -Nitrilotris(propanoic acid methyl) ester|3,3 ,3 -Nitrilotris(propionic acid methyl) ester
| Molecular Formula | C12H21NO6 |
|---|---|
| Molecular Weight | 275.1369 g/mol |
| LogP | -0.3 |
| Topological Polar Surface Area | 82.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Exact Mass | 275.1369 |
| Monoisotopic Mass | 275.1369 |
| Heavy Atoms | 19 |
| Complexity | 257.0 |
Chemical Identifiers
| CAS Number | 6969-06-8 |
|---|---|
| SMILES | COC(=O)CCN(CCC(=O)OC)CCC(=O)OC |
| InChIKey | YDNHCHDMPIHHGH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 3-(bis(2-methoxycarbonylethyl)amino)propanoate (CAS 6969-06-8), with molecular formula C12H21NO6 and molecular weight 275.1369 g/mol. IUPAC: methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate.