1,2-Phenanthrenediol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, (4bS,8aS)-
(4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,2-diol
Also Known As: Totarol deriv|Podocarpa-8,11,13-trien-13,14-diol|J2.589.851F|(4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,2-diol|1,2-Phenanthrenediol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, (4bS,8aS)-|(4bS,8aS)-4b,8,8-trimethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-1,2-diol|1,2-Phenanthrenediol,4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, -|4balpha,8,8-Trimethyl-4b,5,6,7,8,8abeta,9,10-octahydrophenanthrene-1,2-diol
| Molecular Formula | C17H24O2 |
|---|---|
| Molecular Weight | 260.17764 g/mol |
| LogP | 5.2 |
| Topological Polar Surface Area | 40.5 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 0 |
| Exact Mass | 260.17764 |
| Monoisotopic Mass | 260.17764 |
| Heavy Atoms | 19 |
| Complexity | 351.0 |
Chemical Identifiers
| CAS Number | 69748-51-2 |
|---|---|
| SMILES | C[C@]12CCCC([C@@H]1CCC3=C2C=CC(=C3O)O)(C)C |
| InChIKey | UCOVNMMLWVAZJH-WMLDXEAASA-N |
Product Overview
1,2-Phenanthrenediol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-, (4bS,8aS)- (CAS 69748-51-2), with molecular formula C17H24O2 and molecular weight 260.17764 g/mol. IUPAC: (4bS,8aS)-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,2-diol.