N-(4-Hydroxyphenyl)-N'-phenylthiourea
1-(4-hydroxyphenyl)-3-phenylthiourea
Also Known As: N-(4-hydroxyphenyl)-N'-phenylthiourea|PTU 24|4-Hydroxythio-carbanilide|1-(4-hydroxyphenyl)-3-phenylthiourea|4-Hydroxythiocarbanilide|CARBANILIDE, 4-HYDROXYTHIO-|CBMicro_033507|N-Phenyl-N'-4-hydroxyphenylthiourea|Oprea1_140522|N-Phenyl-N'-p-hydroxyphenylthiourea|PTU-24|Thiourea, N-(4-hydroxyphenyl)-N'-phenyl-|KS-00004CO9|1-(4-hydroxyphenyl)-3-phenyl-thiourea|NCGC00246738-01|NCGC00247219-01|N-(4-Hydroxyphenyl)-N -phenylthiourea|BIM-0033497.P001|4-{[(phenylamino)thioxomethyl]amino}phenol|2-13-00-00252 (Beilstein Handbook Reference)
| Molecular Formula | C13H12N2OS |
|---|---|
| Molecular Weight | 244.06703 g/mol |
| LogP | 1.8 |
| Topological Polar Surface Area | 76.4 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 244.06703 |
| Monoisotopic Mass | 244.06703 |
| Heavy Atoms | 17 |
| Complexity | 246.0 |
Chemical Identifiers
| CAS Number | 6986-80-7 |
|---|---|
| SMILES | C1=CC=C(C=C1)NC(=S)NC2=CC=C(C=C2)O |
| InChIKey | PWLPSXPCUHUSAT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 6 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
N-(4-Hydroxyphenyl)-N'-phenylthiourea (CAS 6986-80-7), with molecular formula C13H12N2OS and molecular weight 244.06703 g/mol. IUPAC: 1-(4-hydroxyphenyl)-3-phenylthiourea.