3-Fluoro-5-(trifluoromethyl)benzoic acid
3-fluoro-5-(trifluoromethyl)benzoic acid
Also Known As: 3-Fluoro-5-(trifluoromethyl)benzoic acid|3-fluoro-5-trifluoromethylbenzoic acid|5-Fluoro-1-indanone|Maybridge4_001933|ACMC-1BWLQ|Intermediates-ZCF02214|Benzoic acid, 3-fluoro-5-(trifluoromethyl)-|RARECHEM AL BO 0634|KS-00000CQY|BUTTPARK 32\01-71|ACN-S004336|JRD-0140|3-Fluoro-5-(trifluoromethyl)benzoicAcid|TD1017|A,A,A,-5-Tetrafluoro-M-toluic acid|alpha,alpha,alpha,5-Tetrafluoro-m-toluic Acid|CS-W002290|PS-8046|3-fluoro-5-trifluoromethyl benzoic acid|3-fluoro-5-trifluoromethyl-benzoic acid|NCGC00177103-01|3-Fluoro-2-(trifluoromethyl)benzoic acid
| Molecular Formula | C8H4F4O2 |
|---|---|
| Molecular Weight | 208.01474 g/mol |
| LogP | 2.4 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Exact Mass | 208.01474 |
| Monoisotopic Mass | 208.01474 |
| Heavy Atoms | 14 |
| Complexity | 226.0 |
Chemical Identifiers
| CAS Number | 700-84-5 |
|---|---|
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)C(=O)O |
| InChIKey | NSGKIIGVPBTOBF-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3-Fluoro-5-(trifluoromethyl)benzoic acid (CAS 700-84-5), with molecular formula C8H4F4O2 and molecular weight 208.01474 g/mol. IUPAC: 3-fluoro-5-(trifluoromethyl)benzoic acid.