![Diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate structure](/static/products/7012/7012-60-4.webp)
Diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate
diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate
Also Known As: Diethyl bis(4-dichlorobenzyl)malonate|diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate|Diethyl 2,2-bis(4-chlorobenzyl)malonate|DIETHYL BIS-(4-CHLOROBENZYL)-MALONATE|Diethyl bis[(4-chlorophenyl)methyl]propanedioate|1,3-diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate|1,3-Bis(4-chlorophenyl)-2,2-propanedicarboxylic acid diethyl ester|PROPANEDIOIC ACID,BIS[(4-CHLOROPHENYL)METHYL]-, DIETHYL ESTER (9CI)
| Molecular Formula | C21H22Cl2O4 |
|---|---|
| Molecular Weight | 408.0895 g/mol |
| LogP | 5.9 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Exact Mass | 408.0895 |
| Monoisotopic Mass | 408.0895 |
| Heavy Atoms | 27 |
| Complexity | 437.0 |
Chemical Identifiers
| CAS Number | 7012-60-4 |
|---|---|
| SMILES | CCOC(=O)C(CC1=CC=C(C=C1)Cl)(CC2=CC=C(C=C2)Cl)C(=O)OCC |
| InChIKey | RBCQASOZEMIVSP-UHFFFAOYSA-N |
Product Overview
Diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate (CAS 7012-60-4), with molecular formula C21H22Cl2O4 and molecular weight 408.0895 g/mol. IUPAC: diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate.
Diethyl 2,2-bis[(4-chlorophenyl)methyl]propanedioate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »