Methyl 3-phenyl-3-(pyrrolidin-1-YL)propanoate
methyl 3-phenyl-3-pyrrolidin-1-ylpropanoate
Also Known As: METHYL 3-PHENYL-3-(PYRROLIDIN-1-YL)PROPANOATE|methyl 3-phenyl-3-pyrrolidin-1-ylpropanoate|METHYL3-PHENYL-3-(PYRROLIDIN-1-YL)PROPANOATE|J1.992.103D|beta-Pyrrolizinobenzenepropionic acid methyl ester|3-Pyrrolizino-3-phenylpropanoic acid methyl ester|3-Pyrrolizino-3-phenylpropionic acid methyl ester|beta-Phenyl-1-pyrrolidinepropanoic acid methyl ester|3-phenyl-3-pyrrolidin-1-yl-propionic acid methyl ester
| Molecular Formula | C14H19NO2 |
|---|---|
| Molecular Weight | 233.14159 g/mol |
| LogP | 2.1 |
| Topological Polar Surface Area | 29.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 233.14159 |
| Monoisotopic Mass | 233.14159 |
| Heavy Atoms | 17 |
| Complexity | 243.0 |
Chemical Identifiers
| CAS Number | 7032-65-7 |
|---|---|
| SMILES | COC(=O)CC(C1=CC=CC=C1)N2CCCC2 |
| InChIKey | OSVHNYZORQSSKG-UHFFFAOYSA-N |
Product Overview
Methyl 3-phenyl-3-(pyrrolidin-1-YL)propanoate (CAS 7032-65-7), with molecular formula C14H19NO2 and molecular weight 233.14159 g/mol. IUPAC: methyl 3-phenyl-3-pyrrolidin-1-ylpropanoate.
Methyl 3-phenyl-3-(pyrrolidin-1-YL)propanoate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »