AC1O5CJK
N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid
Also Known As: EINECS 270-166-9|Oleic acid, tetraethylenepentamine amides|Oleic acid, tetraethylenepentamine polymer|(C18-H34-O2.C8-H23-N5)x-|9-Octadecenoic acid (9Z)-, reaction products with tetraethylenepentamine|9-Octadecenoic acid (Z)-, reaction products with tetraethylenepentamine|9-Octadecenoic acid (9Z)-, polymer with N-(2-aminoethyl)-N'-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethanediamine|9-Octadecenoic acid, (Z)-, reaction products with tetraethylenepentamine|N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine; (Z)-octadec-9-enoic acid|9-Octadecanoic acid (Z)-,polymer with N-(2-aminoethyl), N'-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethane diamine|9-Octadecenoic acid (9Z)-, polymer with N-(2-aminoethyl)-N'-(2-((2-aminoethyl)amino)ethyl)-1,2-ethanediamine|9-Octadecenoic acid (9Z)-, polymer with N1-(2-aminoethyl)-N2-(2-((2-aminoethyl)amino)ethyl)-1,2-ethanediamine|9-Octadecenoic acid (Z)-, polymer with N-(2-aminoethyl)-N'-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethanediamine
| Molecular Formula | C26H57N5O2 |
|---|---|
| Molecular Weight | 471.45123 g/mol |
| LogP | 3.7811 |
| Topological Polar Surface Area | 125.43 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Exact Mass | 471.45123 |
| Monoisotopic Mass | 471.45123 |
| Heavy Atoms | 33 |
| Complexity | 384.87854 |
Chemical Identifiers
| CAS Number | 70321-87-8 |
|---|---|
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.C(CNCCNCCNCCN)N |
Product Overview
AC1O5CJK (CAS 70321-87-8), with molecular formula C26H57N5O2 and molecular weight 471.45123 g/mol. IUPAC: N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;(Z)-octadec-9-enoic acid.