Phosphorothioic acid, O,O-dimethyl O-(4-formamido-m-tolyl) ester
N-(4-dimethoxyphosphinothioyloxy-2-methylphenyl)formamide
Also Known As: N-Formylaminofenitrothion|Fenitrothion metabolite|FA-FNT|Phosphorothioic acid, O,O-dimethyl O-(4-formamido-m-tolyl) ester|J1.840.382J|Phosphorothioic acid, O,O-dimethyl O-(4-(formylamino)-3-methylphenyl) ester|N-(4-dimethoxyphosphinothioyloxy-2-methylphenyl)formamide|Phosphorothioic acid, O-(4-(formylamino)-3-methylphenyl) O,O-dimethyl ester|O-4-formamido-3-methylphenyl O,O-dimethyl phosphorothioate|O-(4-Formamido-3-methylphenyl) O,O-dimethyl phosphorothioate|Phosphorothioic acid O,O-dimethyl O-[3-methyl-4-(formylamino)phenyl] ester
| Molecular Formula | C10H14NO4PS |
|---|---|
| Molecular Weight | 275.03812 g/mol |
| LogP | 2.45942 |
| Topological Polar Surface Area | 56.79 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 275.03812 |
| Monoisotopic Mass | 275.03812 |
| Heavy Atoms | 17 |
| Complexity | 443.93207 |
Chemical Identifiers
| CAS Number | 70575-27-8 |
|---|---|
| SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)NC=O |
Product Overview
Phosphorothioic acid, O,O-dimethyl O-(4-formamido-m-tolyl) ester (CAS 70575-27-8), with molecular formula C10H14NO4PS and molecular weight 275.03812 g/mol. IUPAC: N-(4-dimethoxyphosphinothioyloxy-2-methylphenyl)formamide.