Hydroabietyl alcohol
[(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methanol;2-benzofuran-1,3-dione;ethane-1,2-diol
Also Known As: Hydroabietyl alcohol|Hydroabietyl alcohol, ethylene glycol, phthalic anhydride polymer|1,3-Isobenzofurandione, polymer with 1,2-ethanediol, (tetradecahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenyl)methyl ester|1,3-Isobenzofurandione, polymer with 1,2-ethanediol, [tetradecahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenyl]methyl ester|[(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methanol; 2-benzofuran-1,3-dione; ethane-1,2-diol|1,3-Isobenzofurandione, polymer with 1,2-ethanediol, [tetradecahydro-1,4a-dimethyl- 7-(1-methylethyl)-1-phenanthrenyl]methyl ester|Decanoic acid, mixed esters with hexanoic acid, octanoic acid, pentaerythritol and valeric acid
| Molecular Formula | C30H46O6 |
|---|---|
| Molecular Weight | 502.32944 g/mol |
| LogP | 5.2419 |
| Topological Polar Surface Area | 104.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Exact Mass | 502.32944 |
| Monoisotopic Mass | 502.32944 |
| Heavy Atoms | 36 |
| Complexity | 569.0 |
Chemical Identifiers
| CAS Number | 70775-80-3 |
|---|---|
| SMILES | CC(C)C1CC[C@H]2C(C1)CC[C@@H]3[C@@]2(CCC[C@@]3(C)CO)C.C1=CC=C2C(=C1)C(=O)OC2=O.C(CO)O |
| InChIKey | VUUHZPHYZQAEDX-ZWEULETDSA-N |
Product Overview
Hydroabietyl alcohol (CAS 70775-80-3), with molecular formula C30H46O6 and molecular weight 502.32944 g/mol. IUPAC: [(1R,4aR,4bS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methanol;2-benzofuran-1,3-dione;ethane-1,2-diol.