3-Fluoro-4-methylbenzene-1-sulfonyl chloride
3-fluoro-4-methylbenzenesulfonyl chloride
Also Known As: 3-Fluoro-4-methylbenzenesulfonyl chloride|3-fluoro-4-methylbenzene-1-sulfonyl chloride|3-fluoro-4-methylbenzenesulphonyl chloride|buttpark 14511-13|3-fluoro-4-methylbenzenesulfonylchloride|3-fluoro-p-toluenesulphonyl chloride|3-fluoro-4-methyl-benzenesulfonyl Chloride|Benzenesulfonyl chloride, 3-fluoro-4-methyl-|3-FLUORO-P-TOLUENESULFONYL CHLORIDE|BUTTPARK 145\11-13|KS-000011KO|3-fluoro-4-methylphenylsulfonyl chloride|4999AC|ASINEX-REAG BAS 07752345|chloro(3-fluoro-4-methylphenyl)sulfone|4-Fluoro-2-methylbenzenesulfonyl chloride|3-Fluoro-4-methyl benzenesulfonyl chloride|3-fluoro-4-methylbenzene-1-sulfonylchloride|3-fluoro-4-methylbenzenesulphonylchloride98%|Benzenesulfonylchloride, 3-fluoro-4-methyl-
| Molecular Formula | C7H6ClFO2S |
|---|---|
| Molecular Weight | 207.9761 g/mol |
| LogP | 2.06162 |
| Topological Polar Surface Area | 34.14 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 207.9761 |
| Monoisotopic Mass | 207.9761 |
| Heavy Atoms | 12 |
| Complexity | 399.86743 |
Chemical Identifiers
| CAS Number | 7079-48-3 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Product Overview
3-Fluoro-4-methylbenzene-1-sulfonyl chloride (CAS 7079-48-3), with molecular formula C7H6ClFO2S and molecular weight 207.9761 g/mol. IUPAC: 3-fluoro-4-methylbenzenesulfonyl chloride.
3-Fluoro-4-methylbenzene-1-sulfonyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »