4-bromo-N-(cyclohexylcarbamothioyl)benzenesulfonamide
1-(4-bromophenyl)sulfonyl-3-cyclohexylthiourea
Also Known As: 1-brosyl-3-cyclohexyl-thiourea|4-bromo-N-(cyclohexylcarbamothioyl)benzenesulfonamide|1-(4-bromophenyl)sulfonyl-3-cyclohexylthiourea|1-(4-bromophenyl)sulfonyl-3-cyclohexyl-thiourea|F1628-0654|3-(4-BROMOBENZENESULFONYL)-1-CYCLOHEXYLTHIOUREA|4-bromo-N-[(cyclohexylamino)carbonothioyl]benzenesulfonamide|[(4-bromophenyl)sulfonyl][(cyclohexylamino)thioxomethyl]amine|p-bromophenyl-3-cyclohexylthioureido(oxo)-lambda-sulfaniumolate
| Molecular Formula | C13H17BrN2O2S2 |
|---|---|
| Molecular Weight | 375.9915 g/mol |
| LogP | 2.9346 |
| Topological Polar Surface Area | 58.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 375.9915 |
| Monoisotopic Mass | 375.9915 |
| Heavy Atoms | 20 |
| Complexity | 566.5389 |
Chemical Identifiers
| CAS Number | 708993-39-9 |
|---|---|
| SMILES | C1CCC(CC1)NC(=S)NS(=O)(=O)C2=CC=C(C=C2)Br |
Product Overview
4-bromo-N-(cyclohexylcarbamothioyl)benzenesulfonamide (CAS 708993-39-9), with molecular formula C13H17BrN2O2S2 and molecular weight 375.9915 g/mol. IUPAC: 1-(4-bromophenyl)sulfonyl-3-cyclohexylthiourea.
4-bromo-N-(cyclohexylcarbamothioyl)benzenesulfonamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »