AC1MJ4IL
[2-[[2,2-bis(hydroxymethyl)-3-pentanoyloxypropoxy]methyl]-2-(heptanoyloxymethyl)-3-octanoyloxypropyl] decanoate
Also Known As: Decanoic acid mixed esters with dipentaerythritol heptanoic acid octanoic acid and valeric acid|Dipentaerythritol, ester with valeric acid, enanthylic acid, caprylic acid, and capric acid|Decanoic acid, mixed esters with dipentaerythritol, heptanoic acid, octanoic acid and valeric acid|[2-[[2,2-bis(hydroxymethyl)-3-pentanoyloxypropoxy]methyl]-2-(heptanoyloxymethyl)-3-octanoyloxypropyl] decanoate|Decanoic acid, mixed esters with dipentaerythritol, heptanoic acid,octanoic acid and valeric acid
| Molecular Formula | C40H74O11 |
|---|---|
| Molecular Weight | 730.52313 g/mol |
| LogP | 7.795 |
| Topological Polar Surface Area | 154.89 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Exact Mass | 730.52313 |
| Monoisotopic Mass | 730.52313 |
| Heavy Atoms | 51 |
| Complexity | 889.6269 |
Chemical Identifiers
| CAS Number | 71010-75-8 |
|---|---|
| SMILES | CCCCCCCCCC(=O)OCC(COCC(CO)(CO)COC(=O)CCCC)(COC(=O)CCCCCC)COC(=O)CCCCCCC |
Product Overview
AC1MJ4IL (CAS 71010-75-8), with molecular formula C40H74O11 and molecular weight 730.52313 g/mol. IUPAC: [2-[[2,2-bis(hydroxymethyl)-3-pentanoyloxypropoxy]methyl]-2-(heptanoyloxymethyl)-3-octanoyloxypropyl] decanoate.