AC1LJTTS
3-chloro-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide
Also Known As: BAS 09577803|3-chloro-N-{2-[4-(methylsulfonyl)-1-piperazinyl]phenyl}-1-benzothiophene-2-carboxamide|AP-970/42896398|3-chloro-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide|(3-chlorobenzo[b]thiophen-2-yl)-N-{2-[4-(methylsulfonyl)piperazinyl]phenyl}car boxamide|3-chloro-N-(2-(4-(methylsulfonyl)piperazin-1-yl)phenyl)benzo[b]thiophene-2-carboxamide|3-chloro-N-{2-[4-(methylsulfonyl)piperazin-1-yl]phenyl}-1-benzothiophene-2-carboxamide
| Molecular Formula | C20H20ClN3O3S2 |
|---|---|
| Molecular Weight | 449.06348 g/mol |
| LogP | 3.8886 |
| Topological Polar Surface Area | 69.72 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 449.06348 |
| Monoisotopic Mass | 449.06348 |
| Heavy Atoms | 29 |
| Complexity | 1168.6831 |
Chemical Identifiers
| CAS Number | 712290-54-5 |
|---|---|
| SMILES | CS(=O)(=O)N1CCN(CC1)C2=CC=CC=C2NC(=O)C3=C(C4=CC=CC=C4S3)Cl |
Product Overview
AC1LJTTS (CAS 712290-54-5), with molecular formula C20H20ClN3O3S2 and molecular weight 449.06348 g/mol. IUPAC: 3-chloro-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]-1-benzothiophene-2-carboxamide.