![methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate structure](/static/products/7128/71283-65-3.webp)
methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate
methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate
Also Known As: (R)-diclofop-methyl|Diclofop methyl|methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate|Methyl -2-[4- phenoxy]propanoate|Diclofop-P-methyl 100 microg/mL in Acetonitrile|283M653|methyl (2R)-2-(4-(2,4-dichlorophenoxy)phenoxy)propanoate|Propanoic acid, 2-(4-(2,4-dichlorophenoxy)phenoxy)-, methyl ester, (2R)-|Propanoic acid,2-[4-(2,4-dichlorophenoxy)phenoxy]-, methyl ester, (2R)-|(2r)-2-(4-(2,4-dichlorophenoxy)phenoxy)propanoic acid methyl ester|977-864-9|Propanoic acid, 2-[4-(2,4-dichlorophenoxy)phenoxy]-, methyl ester, (R)-; (+)-Diclofop-methyl; (R)-(+)-Diclofop-methyl; (R)-Dichlofop-methyl; (R)-Diclofop-methyl; Diclofop-P-methyl
| Molecular Formula | C16H14Cl2O4 |
|---|---|
| Molecular Weight | 340.02692 g/mol |
| LogP | 4.8 |
| Topological Polar Surface Area | 44.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 340.02692 |
| Monoisotopic Mass | 340.02692 |
| Heavy Atoms | 22 |
| Complexity | 358.0 |
Chemical Identifiers
| CAS Number | 71283-65-3 |
|---|---|
| SMILES | C[C@H](C(=O)OC)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)Cl)Cl |
| InChIKey | BACHBFVBHLGWSL-SNVBAGLBSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate (CAS 71283-65-3), with molecular formula C16H14Cl2O4 and molecular weight 340.02692 g/mol. IUPAC: methyl (2R)-2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate.