2-(4-Methyl-3-pentenyl)anthraquinone
2-(4-methylpent-3-enyl)anthracene-9,10-dione
Also Known As: 2-(4-methyl-3-pentenyl)anthraquinone|MPAQ|2-(4-methylpent-3-enyl)anthracene-9,10-dione|EC 428-320-1|2-(4-Methyl-3-pentene-1-yl)anthraquinone|J1.412.453E|J3.728.878K|2-(4-Methyl-3-pentenyl)-9,10-anthraquinone|2-(4-Methylpent-3-en-1-yl)anthracene-9,10-dione|2-(4-Methyl-3-pentenyl)anthracene-9,10-dione|2-(4-METHYLPENT-3-EN-1-YL)-9,10-DIHYDROANTHRACENE-9,10-DIONE|9,10-Anthracenedione, 2-(4-methyl-3-penten-1-yl)-|(5,6,7,8-24)2-(4-methylpent-3-en-1-yl)anthracene-9,10-dione|(5,6,7,8-24)2-(4-methylpent-3-en-1-yl)-9,10-dihydroanthracene-9,10-dione|428-320-1
| Molecular Formula | C20H18O2 |
|---|---|
| Molecular Weight | 290.13068 g/mol |
| LogP | 5.8 |
| Topological Polar Surface Area | 34.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 290.13068 |
| Monoisotopic Mass | 290.13068 |
| Heavy Atoms | 22 |
| Complexity | 472.0 |
Chemical Identifiers
| CAS Number | 71308-16-2 |
|---|---|
| SMILES | CC(=CCCC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O)C |
| InChIKey | NQVBCGTZRWHVSY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(4-Methyl-3-pentenyl)anthraquinone (CAS 71308-16-2), with molecular formula C20H18O2 and molecular weight 290.13068 g/mol. IUPAC: 2-(4-methylpent-3-enyl)anthracene-9,10-dione.