![[4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid structure](/static/products/7141/71411-65-9.webp)
[4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid
2-[4-(2-phenylpropan-2-yl)phenoxy]acetic acid
Also Known As: [4-(1-methyl-1-phenylethyl)phenoxy]acetic acid|2-[4-(2-phenylpropan-2-yl)phenoxy]acetic Acid|2-(4-(2-phenylpropan-2-yl)phenoxy)acetic acid|Oprea1_329306|8499AE|4-(2-phenylpropan-2-yl)phenoxyacetic acid|[4-(2-phenylpropan-2-yl)phenoxy]acetic acid|[4-(2-Phenyl-2-propanyl)phenoxy]acetic acid|2-4-(2-phenylpropan-2-yl)phenoxyacetic acid|VU0509040-1|2-(4-(2-phenylpropan-2-yl)phenoxy)aceticacid|W-6815|acetic acid, 2-[4-(1-methyl-1-phenylethyl)phenoxy]-|2-[4-(1-methyl-1-phenyl-ethyl)phenoxy]acetic acid|2-[4-(1-methyl-1-phenylethyl)phenoxy]acetic acid|F3097-1475
| Molecular Formula | C17H18O3 |
|---|---|
| Molecular Weight | 270.12558 g/mol |
| LogP | 4.3 |
| Topological Polar Surface Area | 46.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 270.12558 |
| Monoisotopic Mass | 270.12558 |
| Heavy Atoms | 20 |
| Complexity | 310.0 |
Chemical Identifiers
| CAS Number | 71411-65-9 |
|---|---|
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)OCC(=O)O |
| InChIKey | FHCJMUZSWRNFNA-UHFFFAOYSA-N |
Product Overview
[4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid (CAS 71411-65-9), with molecular formula C17H18O3 and molecular weight 270.12558 g/mol. IUPAC: 2-[4-(2-phenylpropan-2-yl)phenoxy]acetic acid.
[4-(1-Methyl-1-phenylethyl)phenoxy]acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »