AC1MHNS1
4-(N-[(2S)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-4-methoxyanilino)butanoic acid
Also Known As: N-(N-(p-Chlorobenzoyl)methionyl)-4-(p-anisidino)butyric acid|Butanoic acid, 4-((2-((4-chlorobenzoyl)amino)-4-(methylthio)-1-oxobutyl)(4-methoxyphenyl)amino)-, (S)-|4-{N-[4-Chloro-N-(4-methoxyphenyl)benzoyl]-L-methionamido}butanoic acid|4-(N-[(2S)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-4-methoxyanilino)butanoic acid|Butanoic acid,4-[[2-[(4-chlorobenzoyl)amino]-4-(methylthio)-1-oxobutyl](4-methoxyphenyl)amino]-,(S)- (9CI)
| Molecular Formula | C23H27ClN2O5S |
|---|---|
| Molecular Weight | 478.13293 g/mol |
| LogP | 4.0981 |
| Topological Polar Surface Area | 95.94 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Exact Mass | 478.13293 |
| Monoisotopic Mass | 478.13293 |
| Heavy Atoms | 32 |
| Complexity | 905.60767 |
Chemical Identifiers
| CAS Number | 71489-32-2 |
|---|---|
| SMILES | COC1=CC=C(C=C1)N(CCCC(=O)O)C(=O)[C@H](CCSC)NC(=O)C2=CC=C(C=C2)Cl |
Product Overview
AC1MHNS1 (CAS 71489-32-2), with molecular formula C23H27ClN2O5S and molecular weight 478.13293 g/mol. IUPAC: 4-(N-[(2S)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]-4-methoxyanilino)butanoic acid.