Ethyl 3-(3-methoxyphenyl)propanoate
ethyl 3-(3-methoxyphenyl)propanoate
Also Known As: Ethyl 3-(3-methoxyphenyl)propanoate|Ethyl3-(3-methoxyphenyl)propanoate|3-(3-Methoxy-phenyl)-propionic acid ethyl ester|3-(3-Methoxyphenyl)propionic acid ethyl ester|3- -PROPIONICACIDETHYLESTER|2,2,3,4,5,6-Hexachlorobiphenyl|ethyl 3-(3-methoxyphenyl)propionate|1043AC|Ethyl 3-(3'-methoxyphenyl)propionate|Ethyl 3-(3-methoxyphenyl)propanoate #|3-(3-methoxyphenyl)propanoic acid ethyl ester|3-Methoxybenzenepropionic acid ethyl ester|3-Methoxy-benzenepropanoic acid ethyl ester|Benzenepropanoic acid,3-methoxy-, ethyl ester
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.10994 g/mol |
| LogP | 2.3 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 208.10994 |
| Monoisotopic Mass | 208.10994 |
| Heavy Atoms | 15 |
| Complexity | 191.0 |
Chemical Identifiers
| CAS Number | 7151-62-4 |
|---|---|
| SMILES | CCOC(=O)CCC1=CC(=CC=C1)OC |
| InChIKey | JKUZROGLCCUHCK-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 3-(3-methoxyphenyl)propanoate (CAS 7151-62-4), with molecular formula C12H16O3 and molecular weight 208.10994 g/mol. IUPAC: ethyl 3-(3-methoxyphenyl)propanoate.