![3,5-Bis[(dimethylamino)methyl]-4-hydroxybenzoic acid structure](/static/products/7154/7154-25-8.webp)
3,5-Bis[(dimethylamino)methyl]-4-hydroxybenzoic acid
3,5-bis[(dimethylamino)methyl]-4-hydroxybenzoic acid
Also Known As: NCIStruc1_000404|NCIStruc2_000612|3,5-bis[(dimethylamino)methyl]-4-hydroxybenzoic acid|NCGC00013444-02|NCGC00096559-01|NCI60_003680|3,5-bis((dimethylamino)methyl)-4-hydroxybenzoic acid|3,5-Bis-dimethylaminomethyl-4-hydroxy-benzoesaeure|Benzoic acid,3,5-bis[(dimethylamino)methyl]-4-hydroxy-|3,5-bis(dimethylaminomethyl)-4-hydroxybenzoic acid
| Molecular Formula | C13H20N2O3 |
|---|---|
| Molecular Weight | 252.1474 g/mol |
| LogP | -1.5 |
| Topological Polar Surface Area | 64.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 252.1474 |
| Monoisotopic Mass | 252.1474 |
| Heavy Atoms | 18 |
| Complexity | 261.0 |
Chemical Identifiers
| CAS Number | 7154-25-8 |
|---|---|
| SMILES | CN(C)CC1=CC(=CC(=C1O)CN(C)C)C(=O)O |
| InChIKey | YGQVYFAHDYFWHO-UHFFFAOYSA-N |
Product Overview
3,5-Bis[(dimethylamino)methyl]-4-hydroxybenzoic acid (CAS 7154-25-8), with molecular formula C13H20N2O3 and molecular weight 252.1474 g/mol. IUPAC: 3,5-bis[(dimethylamino)methyl]-4-hydroxybenzoic acid.
3,5-Bis[(dimethylamino)methyl]-4-hydroxybenzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »