2-[(Methylsulfonyl)amino]phenyl methanesulfonate
[2-(methanesulfonamido)phenyl] methanesulfonate
Also Known As: N-Mesyl-2-(mesyloxy)aniline|2-[(Methylsulfonyl)amino]phenyl methanesulfonate|2-(Methylsulfonamido)phenyl methanesulfonate|N,O-Di[methane sulfonyl]-2-aminophenol|2-(Methylsulfonamido)phenylmethanesulfonate|2-(Methanesulfonamido)phenyl methanesulfonate|Methanesulfonamide,N-[2-[(methylsulfonyl)oxy]phenyl]-|2-(methylsulfonylamino)phenyl methanesulfonate|J2.652.669H|[2-(methanesulfonamido)phenyl] methanesulfonate|2-[(methylsulfonyl)amino]phenyl methylsulfonate|2-[(Methylsulfonyl)amino]phenyl methanesulfonate #|2-METHANESULFONAMIDOPHENYL METHANESULFONATE
| Molecular Formula | C8H11NO5S2 |
|---|---|
| Molecular Weight | 265.00787 g/mol |
| LogP | 0.4 |
| Topological Polar Surface Area | 106.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 265.00787 |
| Monoisotopic Mass | 265.00787 |
| Heavy Atoms | 16 |
| Complexity | 416.0 |
Chemical Identifiers
| CAS Number | 7154-89-4 |
|---|---|
| SMILES | CS(=O)(=O)NC1=CC=CC=C1OS(=O)(=O)C |
| InChIKey | YJVJRNOJGQDOPT-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-[(Methylsulfonyl)amino]phenyl methanesulfonate (CAS 7154-89-4), with molecular formula C8H11NO5S2 and molecular weight 265.00787 g/mol. IUPAC: [2-(methanesulfonamido)phenyl] methanesulfonate.