N-(4-Biphenylyl)-2-naphthylamine
N-(4-phenylphenyl)naphthalen-2-amine
Also Known As: n-(2-naphthyl)biphenyl-4-amine|N-(4-Biphenylyl)-2-naphthylamine|N-(4-phenylphenyl)naphthalen-2-amine|N-(biphenyl-4-yl)Naphthalene-2-aMine|N-([1,1'-Biphenyl]-4-yl)naphthalen-2-amine|N-(naphthalen-2-yl)biphenyl-4-amine|N-(biphenyl-4-yl)naphthalen-2-amine|NCGC00330332-01|N-naphthalene-2-amine -(biphenyl-4-yl)|N-[1,1'-biphenyl]-4-YL-2-naphthalenamine|N-([1,1-biphenyl]-4-yl)naphthalen-2-amine|N-(Naphthalen-2-yl)[1,1'-biphenyl]-4-amine|AB01325021-02|N-(NAPHTHALEN-2-YL)-[1,1'-BIPHENYL]-4-AMINE|842-230-1
| Molecular Formula | C22H17N |
|---|---|
| Molecular Weight | 295.1361 g/mol |
| LogP | 6.3 |
| Topological Polar Surface Area | 12.0 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 295.1361 |
| Monoisotopic Mass | 295.1361 |
| Heavy Atoms | 23 |
| Complexity | 351.0 |
Chemical Identifiers
| CAS Number | 71811-34-2 |
|---|---|
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC4=CC=CC=C4C=C3 |
| InChIKey | JUMBNTOZUIMCEL-UHFFFAOYSA-N |
Product Overview
N-(4-Biphenylyl)-2-naphthylamine (CAS 71811-34-2), with molecular formula C22H17N and molecular weight 295.1361 g/mol. IUPAC: N-(4-phenylphenyl)naphthalen-2-amine.
N-(4-Biphenylyl)-2-naphthylamine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »