AC1MHOLK
1-[2-[4-[(4-chlorophenyl)methyl]phenyl]-2-(methylsulfanylmethoxy)ethyl]imidazole;nitric acid
Also Known As: 1-(beta-Methylthiomethoxy-4-(4'-chlorbenzyl)-phenaethyl)-imidazol-nitrat [German]|1H-Imidazole, 1-(2-(4-((4-chlorophenyl)methyl)phenyl)-2-((methylthio)methoxy)ethyl)-, mononitrate|1-(beta-Methylthiomethoxy-4-(4'-chlorbenzyl)-phenaethyl)-imidazol-nitrat|1-[2-[4-[(4-chlorophenyl)methyl]phenyl]-2-(methylsulfanylmethoxy)ethyl]imidazole; nitric acid|Nitric acid--1-(2-{4-[(4-chlorophenyl)methyl]phenyl}-2-[(methylsulfanyl)methoxy]ethyl)-1H-imidazole (1/1)
| Molecular Formula | C20H22ClN3O4S |
|---|---|
| Molecular Weight | 435.10196 g/mol |
| LogP | 4.858 |
| Topological Polar Surface Area | 90.42 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Exact Mass | 435.10196 |
| Monoisotopic Mass | 435.10196 |
| Heavy Atoms | 29 |
| Complexity | 854.4475 |
Chemical Identifiers
| CAS Number | 71875-66-6 |
|---|---|
| SMILES | CSCOC(CN1C=CN=C1)C2=CC=C(C=C2)CC3=CC=C(C=C3)Cl.[N+](=O)(O)[O-] |
Product Overview
AC1MHOLK (CAS 71875-66-6), with molecular formula C20H22ClN3O4S and molecular weight 435.10196 g/mol. IUPAC: 1-[2-[4-[(4-chlorophenyl)methyl]phenyl]-2-(methylsulfanylmethoxy)ethyl]imidazole;nitric acid.