Glucofuranose, 3-O-butyl-1:2,5:6-di-O-isopropylidene-, alpha-D-
(5R,6S)-6-butoxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole
Also Known As: 3-O-Butyl-1:2,5:6-di-O-isopropylidene-alpha-D-glucofuranose|4-19-00-06105 (Beilstein Handbook Reference)|Glucofuranose, 3-O-butyl-1:2,5:6-di-O-isopropylidene-, alpha-D-|.alpha.-D-Glucofuranose, 3-O-butyl-1,2:5,6-bis-O-(1-methylethylidene)-|(5R,6S)-6-butoxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole
| Molecular Formula | C16H28O6 |
|---|---|
| Molecular Weight | 316.1886 g/mol |
| LogP | 2.1996 |
| Topological Polar Surface Area | 55.38 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Exact Mass | 316.1886 |
| Monoisotopic Mass | 316.1886 |
| Heavy Atoms | 22 |
| Complexity | 396.09726 |
Chemical Identifiers
| CAS Number | 71978-77-3 |
|---|---|
| SMILES | CCCCO[C@H]1[C@H](OC2C1OC(O2)(C)C)[C@H]3COC(O3)(C)C |
Product Overview
Glucofuranose, 3-O-butyl-1:2,5:6-di-O-isopropylidene-, alpha-D- (CAS 71978-77-3), with molecular formula C16H28O6 and molecular weight 316.1886 g/mol. IUPAC: (5R,6S)-6-butoxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.