Ethyl mesitylacetate
ethyl 2-(2,4,6-trimethylphenyl)acetate
Also Known As: ethyl mesitylacetate|Ethyl 2-mesitylacetate|Vinyltriphenoxysilane|ethyl 2-(2,4,6-trimethylphenyl)acetate|ACMC-20akx5|ETHYLMESITYLACETATE|?ETHYL MESITYLACETATE|Mesitylacetic acid ethyl ester|ethyl 2,4,6-trimethylphenylacetate|ethyl 2,4,6-trimethylphenyl acetate|ethyl (2,4,6-trimethylphenyl)acetate|2-Chloro-6-methoxy-3-nitropyridine|Benzeneacetic acid, 2,4,6-trimethyl-, ethyl ester|2,4,6-Trimethylbenzeneacetic acid ethyl ester|ETHYL 2 4 6-TRIMETHYLPHENYL-ACETAT 1ML|Ethyl-2,4,6-trimethylphenylacetate for synthesis|(2,4,6-trimethyl-phenyl)-acetic acid ethyl ester|Benzeneacetic acid,2,4,6-trimethyl-, ethyl ester|I14-90752
| Molecular Formula | C13H18O2 |
|---|---|
| Molecular Weight | 206.13068 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Exact Mass | 206.13068 |
| Monoisotopic Mass | 206.13068 |
| Heavy Atoms | 15 |
| Complexity | 201.0 |
Chemical Identifiers
| CAS Number | 72007-81-9 |
|---|---|
| SMILES | CCOC(=O)CC1=C(C=C(C=C1C)C)C |
| InChIKey | OFZZPFNYAMIBNU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl mesitylacetate (CAS 72007-81-9), with molecular formula C13H18O2 and molecular weight 206.13068 g/mol. IUPAC: ethyl 2-(2,4,6-trimethylphenyl)acetate.