Bis(m-cresyl) p-cresyl phosphate
bis(3-methylphenyl) (4-methylphenyl) phosphate
Also Known As: di(m-tolyl) p-tolyl phosphate|Bis(m-cresyl) p-Cresyl Phosphate|Bis(m-cresyl)p-CresylPhosphate|Bis(m-cresyl) p-Cresyl Phosphate (>90%)|bis(3-methylphenyl) (4-methylphenyl) phosphate|bis(3-methylphenyl) 4-methylphenyl phosphate|J1.161.869C|Phosphoric acid bis(3-methylphenyl)(4-methylphenyl) ester|Phosphoric acid, bis(3-methylphenyl) 4-methylphenyl ester|1-methyl-3-[(3-methylphenoxy)-(4-methylphenoxy)phosphoryl]oxy-benzene|Phosphoric Acid Bis(3-methylphenyl) 4-Methylphenyl Ester; Di-m-cresyl p-Cresyl Phosphate|807-334-3
| Molecular Formula | C21H21O4P |
|---|---|
| Molecular Weight | 368.11774 g/mol |
| LogP | 6.25676 |
| Topological Polar Surface Area | 44.76 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Exact Mass | 368.11774 |
| Monoisotopic Mass | 368.11774 |
| Heavy Atoms | 26 |
| Complexity | 883.2509 |
Chemical Identifiers
| CAS Number | 72016-32-1 |
|---|---|
| SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=CC(=C2)C)OC3=CC=CC(=C3)C |
Product Overview
Bis(m-cresyl) p-cresyl phosphate (CAS 72016-32-1), with molecular formula C21H21O4P and molecular weight 368.11774 g/mol. IUPAC: bis(3-methylphenyl) (4-methylphenyl) phosphate.