RefChem:1056162
(E)-but-2-enedioic acid;2-(dimethylamino)ethyl 8-methyl-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate
Also Known As: Dimethylaminoethyl 8-methyl-2-oxo-1-oxa-3-azaspiro(4.5)decane-3-carboxylate fumarate, (E)-|1-Oxa-3-azaspiro(4.5)decane-3-carboxylic acid, 7-methyl-2-oxo-, 2-dimethylaminoethyl ester, fumarate, (Z)-|Dimethylaminoethyl 7-methyl-2-oxo-1-oxa-3-azaspiro(4.5)decane-3-carboxylate fumarate (Z)-|Methyl-7 oxa-1 oxo-2 aza-3 (dimethylamino ethoxy carbonyl)-3 spiro(4.5)decane fumarate, (Z)-|1-Oxa-3-azaspiro(4.5)decane-3-carboxylic acid, 8-methyl-2-oxo-, 2-dimethylaminoethyl ester, fumarate, (E)-|(E)-but-2-enedioic acid; 2-dimethylaminoethyl 8-methyl-3-oxo-4-oxa-2-azaspiro[4.5]decane-2-carboxylate|1-Oxa-3-azaspiro[4.5]decane-3-carboxylic acid, 8-methyl-2-oxo-, 2-(dimethylamino)ethyl ester, fumarate (1:1), trans-|1-Oxa-3-azaspiro[4.5]decane-3-carboxylic acid, 8-methyl-2-oxo-, 2-(dimethylamino)ethyl ester, trans-, (E)-2-butenedioate (1:1)
| Molecular Formula | C18H28N2O8 |
|---|---|
| Molecular Weight | 400.18457 g/mol |
| LogP | 1.7975 |
| Topological Polar Surface Area | 133.68 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Exact Mass | 400.18457 |
| Monoisotopic Mass | 400.18457 |
| Heavy Atoms | 28 |
| Complexity | 592.70685 |
Chemical Identifiers
| CAS Number | 72017-31-3 |
|---|---|
| SMILES | CC1CCC2(CC1)CN(C(=O)O2)C(=O)OCCN(C)C.C(=C/C(=O)O)\C(=O)O |
Product Overview
RefChem:1056162 (CAS 72017-31-3), with molecular formula C18H28N2O8 and molecular weight 400.18457 g/mol. IUPAC: (E)-but-2-enedioic acid;2-(dimethylamino)ethyl 8-methyl-2-oxo-1-oxa-3-azaspiro[4.5]decane-3-carboxylate.