AC1MHOUJ
5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione
Also Known As: Methylphenylethyl hydantoin and tridione|Tridione and methylphenylethyl hydantoin|2,4-Oxazolidinedione, 3,5,5-trimethyl-, mixed with 5-ethyl-3-methyl-5-phenylhydantoin (1:1)|3,5,5-Trimethyl-1,3-oxazolidine-2,4-dione--5-ethyl-2-hydroxy-3-methyl-5-phenyl-3,5-dihydro-4H-imidazol-4-one (1/1)|2,4-Oxazolidinedione, 3,5,5-trimethyl-, mixt. with 5-ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione|5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione; 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione
| Molecular Formula | C18H23N3O5 |
|---|---|
| Molecular Weight | 361.16376 g/mol |
| LogP | 1.8471 |
| Topological Polar Surface Area | 96.02 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 361.16376 |
| Monoisotopic Mass | 361.16376 |
| Heavy Atoms | 26 |
| Complexity | 746.45325 |
Chemical Identifiers
| CAS Number | 72027-60-2 |
|---|---|
| SMILES | CCC1(C(=O)N(C(=O)N1)C)C2=CC=CC=C2.CC1(C(=O)N(C(=O)O1)C)C |
Product Overview
AC1MHOUJ (CAS 72027-60-2), with molecular formula C18H23N3O5 and molecular weight 361.16376 g/mol. IUPAC: 5-ethyl-3-methyl-5-phenylimidazolidine-2,4-dione;3,5,5-trimethyl-1,3-oxazolidine-2,4-dione.