5,5-Dimethyl-3-(p-phenylphenyl)cyclohex-2-en-1-one
5,5-dimethyl-3-(4-phenylphenyl)cyclohex-2-en-1-one
Also Known As: 5,5-Dimethyl-3- cyclohex-2-enone|5,5-Dimethyl-3-(p-phenylphenyl)cyclohex-2-en-1-one|NCGC00247358-01|5,5-Dimethyl-3-(p-phenylphenyl)cyclohex-2-enone|5,5-dimethyl-3-(4-phenylphenyl)cyclohex-2-en-1-one|5,5-Dimethyl-3-(p-phenylphenyl)-cyclohex-2-en-1-one|1~5~,1~5~-Dimethyl-1~5~,1~6~-dihydro[1~1~,2~1~:2~4~,3~1~-terphenyl]-1~3~(1~4~H)-one
| Molecular Formula | C20H20O |
|---|---|
| Molecular Weight | 276.15143 g/mol |
| LogP | 4.5 |
| Topological Polar Surface Area | 17.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Exact Mass | 276.15143 |
| Monoisotopic Mass | 276.15143 |
| Heavy Atoms | 21 |
| Complexity | 404.0 |
Chemical Identifiers
| CAS Number | 72036-53-4 |
|---|---|
| SMILES | CC1(CC(=CC(=O)C1)C2=CC=C(C=C2)C3=CC=CC=C3)C |
| InChIKey | KZFBORHKRNSIDA-UHFFFAOYSA-N |
Product Overview
5,5-Dimethyl-3-(p-phenylphenyl)cyclohex-2-en-1-one (CAS 72036-53-4), with molecular formula C20H20O and molecular weight 276.15143 g/mol. IUPAC: 5,5-dimethyl-3-(4-phenylphenyl)cyclohex-2-en-1-one.
5,5-Dimethyl-3-(p-phenylphenyl)cyclohex-2-en-1-one is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »