AC1MHP0Y
(1S,2S)-2-amino-1-phenylpropan-1-ol;3,3-bis(4-hydroxyphenyl)-1H-indol-2-one;2-methyl-1-phenylpropan-2-amine
Also Known As: Norpseudoephedrin, d-, mixed with alpha,alpha-dimethylphenethylamine and 3,3-di(4-hydroxyphenyl)indolin-2-one|2H-Indol-2-one, 1,3-dihydro-3,3-bis(4-hydroxyphenyl)-, mixt. with (S-(R*,R*))-alpha-(1-aminoethyl)benzenemethanol and alpha,alpha-dimethylbenzeneethanamine|(1S,2S)-2-amino-1-phenylpropan-1-ol; 3,3-bis(4-hydroxyphenyl)-1H-indol-2-one; 2-methyl-1-phenylpropan-2-amine|2H-Indol-2-one, 1,3-dihydro-3,3-bis(4-hydroxyphenyl)-, mixt. with [S-(R*,R*)]-.alpha.-(1-aminoethyl)benzenemethanol and .alpha.,.alpha.-dimethylbenzeneethanamine
| Molecular Formula | C39H43N3O4 |
|---|---|
| Molecular Weight | 617.3254 g/mol |
| LogP | 6.4179 |
| Topological Polar Surface Area | 141.83 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 617.3254 |
| Monoisotopic Mass | 617.3254 |
| Heavy Atoms | 46 |
| Complexity | 1636.769 |
Chemical Identifiers
| CAS Number | 72050-93-2 |
|---|---|
| SMILES | C[C@@H]([C@H](C1=CC=CC=C1)O)N.CC(C)(CC1=CC=CC=C1)N.C1=CC=C2C(=C1)C(C(=O)N2)(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
Product Overview
AC1MHP0Y (CAS 72050-93-2), with molecular formula C39H43N3O4 and molecular weight 617.3254 g/mol. IUPAC: (1S,2S)-2-amino-1-phenylpropan-1-ol;3,3-bis(4-hydroxyphenyl)-1H-indol-2-one;2-methyl-1-phenylpropan-2-amine.