Ethyl 4-(3-(5-ethylfuran-2-yl)propanamido)benzoate
ethyl 4-[3-(5-ethylfuran-2-yl)propanoylamino]benzoate
Also Known As: ethyl 4-(3-(5-ethylfuran-2-yl)propanamido)benzoate|BAS 09687317|ETHYL 4-[3-(5-ETHYLFURAN-2-YL)PROPANAMIDO]BENZOATE|ethyl 4-[3-(5-ethylfuran-2-yl)propanoylamino]benzoate|F1711-0325|AF-399/42649869|SR-01000367239-1|ethyl 4-[3-(5-ethyl-2-furyl)propanoylamino]benzoate|ethyl p-[3-(5-ethyl-2-furyl)propionylamino]benzoate|ethyl 4-{[3-(5-ethyl-2-furyl)propanoyl]amino}benzoate|4-[3-(5-Ethyl-furan-2-yl)-propionylamino]-benzoic acid ethyl ester|ethyl 4-{[3-(5-ethylfuran-2-yl)propanoyl]amino}benzoate
| Molecular Formula | C18H21NO4 |
|---|---|
| Molecular Weight | 315.14706 g/mol |
| LogP | 3.1 |
| Topological Polar Surface Area | 68.5 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Exact Mass | 315.14706 |
| Monoisotopic Mass | 315.14706 |
| Heavy Atoms | 23 |
| Complexity | 390.0 |
Chemical Identifiers
| CAS Number | 720677-75-8 |
|---|---|
| SMILES | CCC1=CC=C(O1)CCC(=O)NC2=CC=C(C=C2)C(=O)OCC |
| InChIKey | VPZQDGFPCVCBCU-UHFFFAOYSA-N |
Product Overview
Ethyl 4-(3-(5-ethylfuran-2-yl)propanamido)benzoate (CAS 720677-75-8), with molecular formula C18H21NO4 and molecular weight 315.14706 g/mol. IUPAC: ethyl 4-[3-(5-ethylfuran-2-yl)propanoylamino]benzoate.