Benzenemethanamine, N-(phenylmethyl)-, acetate (1:1)
acetic acid;N-benzyl-1-phenylmethanamine
Also Known As: Dibenzylamine acetate|DIBENZYLAMINE MONOACETATE|acetic acid; dibenzyl amine|N,N-Bis(phenylmethyl)acetamide|Benzenemethanamine, N-(phenylmethyl)-, acetate|N-(Phenylmethyl)benzenemethanamide acetate|acetic acid;N-benzyl-1-phenylmethanamine|acetic acid; N-benzyl-1-phenylmethanamine|Benzenemethanamide, N-(phenylmethyl)-, acetate|Benzenemethanamine, N-(phenylmethyl)-, acetate (1:1)|Acetic acid--N-benzyl-1-phenylmethanamine (1/1)
| Molecular Formula | C16H19NO2 |
|---|---|
| Molecular Weight | 257.14157 g/mol |
| LogP | 3.0673 |
| Topological Polar Surface Area | 49.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 257.14157 |
| Monoisotopic Mass | 257.14157 |
| Heavy Atoms | 19 |
| Complexity | 168.0 |
Chemical Identifiers
| CAS Number | 72088-84-7 |
|---|---|
| SMILES | CC(=O)O.C1=CC=C(C=C1)CNCC2=CC=CC=C2 |
| InChIKey | MTZKXRGZXUJKIU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzenemethanamine, N-(phenylmethyl)-, acetate (1:1) (CAS 72088-84-7), with molecular formula C16H19NO2 and molecular weight 257.14157 g/mol. IUPAC: acetic acid;N-benzyl-1-phenylmethanamine.