AC1L41B3
ethyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid
Also Known As: (C5-H8-O2.C4-H6-O2.(C2H4-O)mult-C4-H6-O2)x-|Ethyl Prop-2-enoate; 2-hydroxyethyl 2-methylprop-2-enoate; 2-methylprop-2-enoic Acid|2-Propenoic acid, 2-methyl-, polymers with Et acrylate and polyethylene glycol monomethacrylate C12-14-alkyl ethers|2-Propenoic acid, 2-methyl-, polymers with Et acrylate and polyethylene glycol methacrylate C12-14-alkyl ethers|2-Propenoic acid, 2-methyl-, polymers with ethyl acrylate and polyethylene glycol monomethacrylate C12-14-alkyl ethers
| Molecular Formula | C15H24O7 |
|---|---|
| Molecular Weight | 316.1522 g/mol |
| LogP | 1.4806 |
| Topological Polar Surface Area | 110.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Exact Mass | 316.1522 |
| Monoisotopic Mass | 316.1522 |
| Heavy Atoms | 22 |
| Complexity | 277.0 |
Chemical Identifiers
| CAS Number | 72275-83-3 |
|---|---|
| SMILES | CCOC(=O)C=C.CC(=C)C(=O)O.CC(=C)C(=O)OCCO |
| InChIKey | KCUBDWDSHMYQLL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
AC1L41B3 (CAS 72275-83-3), with molecular formula C15H24O7 and molecular weight 316.1522 g/mol. IUPAC: ethyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.