N-benzyl-N-[10-[benzyl(carbonochloridoyl)amino]anthracen-9-yl]carbamoyl chloride
N-benzyl-N-[10-[benzyl(carbonochloridoyl)amino]anthracen-9-yl]carbamoyl chloride
Also Known As: J1.814.053E|Anthracene-9,10-diylbis(benzylcarbamoyl chloride)|N-benzyl-N-[10-[benzyl(carbonochloridoyl)amino]anthracen-9-yl]carbamoyl chloride|N,N -(9,10-Anthracenediyl)bis(benzylcarbamic acid chloride)|[benzyl-[10-(benzyl-carbonochloridoyl-amino)anthracen-9-yl]amino]formyl Chloride|N-BENZYL-N-{10-[BENZYL(CHLOROCARBONYL)AMINO]ANTHRACEN-9-YL}CARBAMOYL CHLORIDE
| Molecular Formula | C30H22Cl2N2O2 |
|---|---|
| Molecular Weight | 512.10583 g/mol |
| LogP | 8.7238 |
| Topological Polar Surface Area | 40.62 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 512.10583 |
| Monoisotopic Mass | 512.10583 |
| Heavy Atoms | 36 |
| Complexity | 1381.2163 |
Chemical Identifiers
| CAS Number | 7233-51-4 |
|---|---|
| SMILES | C1=CC=C(C=C1)CN(C2=C3C=CC=CC3=C(C4=CC=CC=C42)N(CC5=CC=CC=C5)C(=O)Cl)C(=O)Cl |
Product Overview
N-benzyl-N-[10-[benzyl(carbonochloridoyl)amino]anthracen-9-yl]carbamoyl chloride (CAS 7233-51-4), with molecular formula C30H22Cl2N2O2 and molecular weight 512.10583 g/mol. IUPAC: N-benzyl-N-[10-[benzyl(carbonochloridoyl)amino]anthracen-9-yl]carbamoyl chloride.
N-benzyl-N-[10-[benzyl(carbonochloridoyl)amino]anthracen-9-yl]carbamoyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »