Diethyl (3-phenoxypropyl)malonate
diethyl 2-(3-phenoxypropyl)propanedioate
Also Known As: diethyl2- propanedioate|diethyl (3-phenoxypropyl)malonate|CBMicro_019286|diethyl 2-(3-phenoxypropyl)propanedioate|diethyl(3-phenoxypropyl)propanedioate|CCG-7313|diethyl 2-(3-phenoxypropyl)malonate|Diethyl (3-phenoxypropyl)propanedioate|BIM-0019296.P001|2-(3-Phenoxypropyl)malonic acid diethyl ester|AB00082909-01|Propanedioic acid,2-(3-phenoxypropyl)-, 1,3-diethyl ester|SR-01000206979-1|1,3-DIETHYL 2-(3-PHENOXYPROPYL)PROPANEDIOATE|5-Phenoxy-2-aethoxycarbonyl-valeriansaeure-aethylester
| Molecular Formula | C16H22O5 |
|---|---|
| Molecular Weight | 294.14673 g/mol |
| LogP | 3.3 |
| Topological Polar Surface Area | 61.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Exact Mass | 294.14673 |
| Monoisotopic Mass | 294.14673 |
| Heavy Atoms | 21 |
| Complexity | 292.0 |
Chemical Identifiers
| CAS Number | 7252-77-9 |
|---|---|
| SMILES | CCOC(=O)C(CCCOC1=CC=CC=C1)C(=O)OCC |
| InChIKey | AMGGSCWBFBWZTO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Diethyl (3-phenoxypropyl)malonate (CAS 7252-77-9), with molecular formula C16H22O5 and molecular weight 294.14673 g/mol. IUPAC: diethyl 2-(3-phenoxypropyl)propanedioate.