((2,3,4-Trichlorophenyl)thio)acetic acid
2-(2,3,4-trichlorophenyl)sulfanylacetic acid
Also Known As: [ thio]aceticacid|((2,3,4-Trichlorophenyl)thio)acetic acid|EINECS 276-230-2|2-(2,3,4-trichlorophenyl)sulfanylacetic acid|[(2,3,4-trichlorophenyl)sulfanyl]acetic acid|KST-1A7870|2-((2,3,4-Trichlorophenyl)thio)acetic acid|2-[(2,3,4-Trichlorophenyl)thio]acetic acid|2-[(2,3,4-trichlorophenyl)sulfanyl]acetic acid|NCGC00332727-01|[(2,3,4-trichlorophenyl)thio]acetic acid|AB00084033-01|AB00084033-04|AS-871/10526049
| Molecular Formula | C8H5Cl3O2S |
|---|---|
| Molecular Weight | 269.9076 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 62.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 269.9076 |
| Monoisotopic Mass | 269.9076 |
| Heavy Atoms | 14 |
| Complexity | 215.0 |
Chemical Identifiers
| CAS Number | 7253-99-8 |
|---|---|
| SMILES | C1=CC(=C(C(=C1SCC(=O)O)Cl)Cl)Cl |
| InChIKey | WYGFOYJKRHDDBG-UHFFFAOYSA-N |
Product Overview
((2,3,4-Trichlorophenyl)thio)acetic acid (CAS 7253-99-8), with molecular formula C8H5Cl3O2S and molecular weight 269.9076 g/mol. IUPAC: 2-(2,3,4-trichlorophenyl)sulfanylacetic acid.
((2,3,4-Trichlorophenyl)thio)acetic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »