Naphthalenesulfonic acid, diisononyl-, compd. with 1,2-ethanediamine (2:1)
bis(2,3-bis(7-methyloctyl)naphthalene-1-sulfonic acid);ethane-1,2-diamine
Also Known As: C28H44O3S.1/2C2H8N2|Naphthalenesulfonic acid, diisononyl-, compd. with 1,2-ethanediamine (2:1)|C28-H44-O3-S.1/2C2-H8-N2|Diisononylnaphthalenesulfonic acid, compd. with 1,2-ethanediamine (2:1)|2,3-bis(7-methyloctyl)naphthalene-1-sulfonic acid- ethane-1,2-diamine(2:1)|Diisononylnaphthalenesulphonic acid, compound with ethane-1,2-diamine (2:1)|2,3-bis(7-methyloctyl)naphthalene-1-sulfonic acid,ethane-1,2-diamine|2,3-bis(7-methyloctyl)naphthalene-1-sulfonic acid; ethane-1,2-diamine|Naphthalenesulfonic acid,diisononyl-,compd. with 1,2-ethanediamine (2:1)|2,3-Bis(7-methyloctyl)naphthalene-1-sulfonic acid--ethane-1,2-diamine (2/1)|Naphthalenesulfonic acid, diisononyl-, compound with 1,2-ethanediamine (2:1)
| Molecular Formula | C58H96N2O6S2 |
|---|---|
| Molecular Weight | 980.67096 g/mol |
| LogP | 15.6728 |
| Topological Polar Surface Area | 178.0 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Exact Mass | 980.67096 |
| Monoisotopic Mass | 980.67096 |
| Heavy Atoms | 68 |
| Complexity | 598.0 |
Chemical Identifiers
| CAS Number | 7255-72-3 |
|---|---|
| SMILES | CC(C)CCCCCCC1=CC2=CC=CC=C2C(=C1CCCCCCC(C)C)S(=O)(=O)O.CC(C)CCCCCCC1=CC2=CC=CC=C2C(=C1CCCCCCC(C)C)S(=O)(=O)O.C(CN)N |
| InChIKey | WOKPRSIJOKBCDU-UHFFFAOYSA-N |
Product Overview
Naphthalenesulfonic acid, diisononyl-, compd. with 1,2-ethanediamine (2:1) (CAS 7255-72-3), with molecular formula C58H96N2O6S2 and molecular weight 980.67096 g/mol. IUPAC: bis(2,3-bis(7-methyloctyl)naphthalene-1-sulfonic acid);ethane-1,2-diamine.