RU 25591
(5R,7R)-N,N-dimethyl-5-(4-nitrophenoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-amine
Also Known As: RU 25591|(5R,7R)-N,N-dimethyl-5-(4-nitrophenoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-amine|5H-Benzocyclohepten-7-amine, 6,7,8,9-tetrahydro-N,N-dimethyl-5-(4-nitrophenoxy)-, cis-|6,7,8,9-Tetrahydro-N,N-dimethyl-5-(nitrophenyl)oxy-5H-benzocycloheptene-7-amine fumarate|6,7,8,9-Tetrahydro-N,N-dimethyl-5alpha-(4-nitrophenoxy)-5H-benzocyclohepten-7alpha-amine|cis N,N-dimethyl-5-[4-nitrophenoxy]-6,7,8,9-tetrahydro-5H-benzocyclohepten-7-amine|cis N,N-dimethyl-5-[4-nitrophenoxy]-6,7,8,9-tetrahydro-benzocycloheptene-7-amine
| Molecular Formula | C19H22N2O3 |
|---|---|
| Molecular Weight | 326.16306 g/mol |
| LogP | 4.1 |
| Topological Polar Surface Area | 58.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 326.16306 |
| Monoisotopic Mass | 326.16306 |
| Heavy Atoms | 24 |
| Complexity | 415.0 |
Chemical Identifiers
| CAS Number | 72575-45-2 |
|---|---|
| SMILES | CN(C)[C@@H]1CCC2=CC=CC=C2[C@@H](C1)OC3=CC=C(C=C3)[N+](=O)[O-] |
| InChIKey | ASNYPHGOFQAGQM-VQIMIIECSA-N |
Product Overview
RU 25591 (CAS 72575-45-2), with molecular formula C19H22N2O3 and molecular weight 326.16306 g/mol. IUPAC: (5R,7R)-N,N-dimethyl-5-(4-nitrophenoxy)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-amine.