Barbituric acid, 5-(1-cyclohexen-1-yl)-1,3,5-trimethyl-
5-(cyclohexen-1-yl)-1,3,5-trimethyl-1,3-diazinane-2,4,6-trione
Also Known As: Hexobarbital Me|2,4,6 -Pyrimidinet|Hexobarbital permethylated|3-Methyl derivative of Hexobarbital|Barbituric acid, 5-(1-cyclohexen-1-yl)-1,3,5-trimethyl-|5-(1-Cyclohexen-1-yl)-1,3,5-trimethylbarbituric acid|2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(1-cyclohexen-1-yl)-1,3,5-trimethyl-|5-(cyclohexen-1-yl)-1,3,5-trimethyl-1,3-diazinane-2,4,6-trione|5-(1-Cyclohexen-1-yl)-1,3,5-trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione|5-(cyclohex-1-en-1-yl)-1,3,5-trimethyl-1,3-diazinane-2,4,6-trione|5-(1-Cyclohexen-1-yl)-1,3,5-trimethyl-2,4,6(1H,3H,5H)-pyrimidinetrione #
| Molecular Formula | C13H18N2O3 |
|---|---|
| Molecular Weight | 250.13174 g/mol |
| LogP | 1.7 |
| Topological Polar Surface Area | 57.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 250.13174 |
| Monoisotopic Mass | 250.13174 |
| Heavy Atoms | 18 |
| Complexity | 429.0 |
Chemical Identifiers
| CAS Number | 726-79-4 |
|---|---|
| SMILES | CC1(C(=O)N(C(=O)N(C1=O)C)C)C2=CCCCC2 |
| InChIKey | PCTJGZPAPPNSKM-UHFFFAOYSA-N |
Product Overview
Barbituric acid, 5-(1-cyclohexen-1-yl)-1,3,5-trimethyl- (CAS 726-79-4), with molecular formula C13H18N2O3 and molecular weight 250.13174 g/mol. IUPAC: 5-(cyclohexen-1-yl)-1,3,5-trimethyl-1,3-diazinane-2,4,6-trione.