Alpha-methyl-3,5-di-tert-butyl-4-hydroxybenzylamine
4-(1-aminoethyl)-2,6-ditert-butylphenol
Also Known As: 4-(1-aminoethyl)-2,6-di-tert-butylphenol|Oprea1_145341|BH 3|BH-3|4-(1-aminoethyl)-2,6-ditert-butylphenol|1-(3,5-di-t-butyl-4-hydroxyphenyl)ethylamine|alpha-Methyl-3,5-di-tert-butyl-4-hydroxybenzylamine|4-hydroxy-3,5-di-tert-butyl-|A-methylbenzylamine|2,6-Di-tert-butyl-4-(aminomethyl)phenol hydrochloride|4-(1-Aminoethyl)-2,6-bis(1,1-dimethylethyl)phenol|Phenol, 4-(1-aminoethyl)-2,6-bis(1,1-dimethylethyl)-|PHENOL, 4-(1-AMINOETHYL)-2,6-DI-TERT-BUTYL-|4-HYDROXY-3,5-DI-TERT-BUTYL-.ALPHA.-METHYLBENZYLAMINE
| Molecular Formula | C16H27NO |
|---|---|
| Molecular Weight | 249.20926 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 46.3 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Exact Mass | 249.20926 |
| Monoisotopic Mass | 249.20926 |
| Heavy Atoms | 18 |
| Complexity | 250.0 |
Chemical Identifiers
| CAS Number | 728-39-2 |
|---|---|
| SMILES | CC(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)N |
| InChIKey | DNISYQIZVIFCRA-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Alpha-methyl-3,5-di-tert-butyl-4-hydroxybenzylamine (CAS 728-39-2), with molecular formula C16H27NO and molecular weight 249.20926 g/mol. IUPAC: 4-(1-aminoethyl)-2,6-ditert-butylphenol.