alpha-L-Lyxopyranose
(2R,3R,4R,5S)-oxane-2,3,4,5-tetrol
Also Known As: alpha-L-lyxopyranose|xylose|alpha-L-lyxose|Pentopyranose|L(+)-Arabinose|a-L-Lyx|Lyxopyranose, alpha-L-|starbld0026493|L-ARABINOPYRANOSE|GlyTouCan:G27459WV|alpha-L-lyxo-pentopyranose|alpha-L-Lyxopyranose (9CI)|.ALPHA.-L-LYXOPYRANOSE|(2R,3R,4R,5S)-oxane-2,3,4,5-tetrol|LYXOPYRANOSE, .ALPHA.-L-|G27459WV|EINECS 201-767-6|5-De(hydroxymethyl)-beta-D-gulopyranose|K568|J3.537.589I|(2R,3R,4R,5S)-Tetrahydro-2H-pyran-2,3,4,5-tetraol|(2R,3R,4R,5S)-tetrahydropyran-2,3,4,5-tetrol|WURCS=2.0/1,1,0/[a221h-1a_1-5]/1/
| Molecular Formula | C5H10O5 |
|---|---|
| Molecular Weight | 150.05283 g/mol |
| LogP | -2.5 |
| Topological Polar Surface Area | 90.2 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 0 |
| Exact Mass | 150.05283 |
| Monoisotopic Mass | 150.05283 |
| Heavy Atoms | 10 |
| Complexity | 117.0 |
Chemical Identifiers
| CAS Number | 7283-06-9 |
|---|---|
| SMILES | C1[C@@H]([C@H]([C@H]([C@@H](O1)O)O)O)O |
| InChIKey | SRBFZHDQGSBBOR-NRXMZTRTSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
alpha-L-Lyxopyranose (CAS 7283-06-9), with molecular formula C5H10O5 and molecular weight 150.05283 g/mol. IUPAC: (2R,3R,4R,5S)-oxane-2,3,4,5-tetrol.